C13H14N6O2S — CID 2224520
2-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]benzamide (PubChem CID 2224520) has the molecular formula C13H14N6O2S and a molecular weight of 318.36 g/mol. Its IUPAC name is 2-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]benzamide.
| Compound Name | 2-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 2224520 |
| Molecular Formula | C13H14N6O2S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]benzamide |
| SMILES | NC(=O)c1ccccc1NC(=O)CSc1nc(N)cc(N)n1 |
| InChI | InChI=1S/C13H14N6O2S/c14-9-5-10(15)19-13(18-9)22-6-11(20)17-8-4-2-1-3-7(8)12(16)21/h1-5H,6H2,(H2,16,21)(H,17,20)(H4,14,15,18,19) |
| InChIKey | QEJVEGOHVJSCJJ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 150.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |