C13H10N3O3S- — CID 4070363
2-[(2-pyrimidin-2-ylsulfanylacetyl)amino]benzoate (PubChem CID 4070363) has the molecular formula C13H10N3O3S- and a molecular weight of 288.31 g/mol. Its IUPAC name is 2-[(2-pyrimidin-2-ylsulfanylacetyl)amino]benzoate.
| Compound Name | 2-[(2-pyrimidin-2-ylsulfanylacetyl)amino]benzoate |
|---|---|
| PubChem CID | 4070363 |
| Molecular Formula | C13H10N3O3S- |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2-[(2-pyrimidin-2-ylsulfanylacetyl)amino]benzoate |
| SMILES | O=C(CSc1ncccn1)Nc1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C13H11N3O3S/c17-11(8-20-13-14-6-3-7-15-13)16-10-5-2-1-4-9(10)12(18)19/h1-7H,8H2,(H,16,17)(H,18,19)/p-1 |
| InChIKey | JATNSTMICLPIJO-UHFFFAOYSA-M |
| XLogP | 0.57 |
| TPSA | 95.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |