C7H9N3OS — CID 21061194
N-methyl-2-pyrimidin-2-ylsulfanylacetamide (PubChem CID 21061194) has the molecular formula C7H9N3OS and a molecular weight of 183.24 g/mol. Its IUPAC name is N-methyl-2-pyrimidin-2-ylsulfanylacetamide.
| Compound Name | N-methyl-2-pyrimidin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 21061194 |
| Molecular Formula | C7H9N3OS |
| Molecular Weight | 183.24 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | N-methyl-2-pyrimidin-2-ylsulfanylacetamide |
| SMILES | CNC(=O)CSc1ncccn1 |
| InChI | InChI=1S/C7H9N3OS/c1-8-6(11)5-12-7-9-3-2-4-10-7/h2-4H,5H2,1H3,(H,8,11) |
| InChIKey | NYDZMCYRIBQOJY-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.24 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |