C8H11N3OS — CID 39082382
N-ethyl-2-pyrimidin-2-ylsulfanylacetamide (PubChem CID 39082382) has the molecular formula C8H11N3OS and a molecular weight of 197.26 g/mol. Its IUPAC name is N-ethyl-2-pyrimidin-2-ylsulfanylacetamide.
| Compound Name | N-ethyl-2-pyrimidin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 39082382 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | N-ethyl-2-pyrimidin-2-ylsulfanylacetamide |
| SMILES | CCNC(=O)CSc1ncccn1 |
| InChI | InChI=1S/C8H11N3OS/c1-2-9-7(12)6-13-8-10-4-3-5-11-8/h3-5H,2,6H2,1H3,(H,9,12) |
| InChIKey | IGQWDQOLHCGPDK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |