C9H12N4O3S — CID 70134863
(2S)-2-amino-3-[(2-pyrimidin-2-ylsulfanylacetyl)amino]propanoic acid (PubChem CID 70134863) has the molecular formula C9H12N4O3S and a molecular weight of 256.29 g/mol. Its IUPAC name is (2S)-2-amino-3-[(2-pyrimidin-2-ylsulfanylacetyl)amino]propanoic acid.
| Compound Name | (2S)-2-amino-3-[(2-pyrimidin-2-ylsulfanylacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 70134863 |
| Molecular Formula | C9H12N4O3S |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | (2S)-2-amino-3-[(2-pyrimidin-2-ylsulfanylacetyl)amino]propanoic acid |
| SMILES | N[C@@H](CNC(=O)CSc1ncccn1)C(=O)O |
| InChI | InChI=1S/C9H12N4O3S/c10-6(8(15)16)4-13-7(14)5-17-9-11-2-1-3-12-9/h1-3,6H,4-5,10H2,(H,13,14)(H,15,16)/t6-/m0/s1 |
| InChIKey | GTWIVFPJRIONDZ-LURJTMIESA-N |
| XLogP | -0.90 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |