C8H11N3O2S — CID 63035392
2-amino-4-pyrimidin-2-ylsulfanylbutanoic acid (PubChem CID 63035392) has the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. Its IUPAC name is 2-amino-4-pyrimidin-2-ylsulfanylbutanoic acid.
| Compound Name | 2-amino-4-pyrimidin-2-ylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 63035392 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 2-amino-4-pyrimidin-2-ylsulfanylbutanoic acid |
| SMILES | NC(CCSc1ncccn1)C(=O)O |
| InChI | InChI=1S/C8H11N3O2S/c9-6(7(12)13)2-5-14-8-10-3-1-4-11-8/h1,3-4,6H,2,5,9H2,(H,12,13) |
| InChIKey | PLUYWPQXBFWVCR-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |