C5H11N3O3 — CID 14721793
2-amino-3-[(2-aminoacetyl)amino]propanoic acid (PubChem CID 14721793) has the molecular formula C5H11N3O3 and a molecular weight of 161.16 g/mol. Its IUPAC name is 2-amino-3-[(2-aminoacetyl)amino]propanoic acid.
| Compound Name | 2-amino-3-[(2-aminoacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 14721793 |
| Molecular Formula | C5H11N3O3 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 2-amino-3-[(2-aminoacetyl)amino]propanoic acid |
| SMILES | NCC(=O)NCC(N)C(=O)O |
| InChI | InChI=1S/C5H11N3O3/c6-1-4(9)8-2-3(7)5(10)11/h3H,1-2,6-7H2,(H,8,9)(H,10,11) |
| InChIKey | PXDPRTAGQLLACU-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |