C7H15N3O3 — CID 123589303
2-amino-3-(3-aminobutanoylamino)propanoic acid (PubChem CID 123589303) has the molecular formula C7H15N3O3 and a molecular weight of 189.22 g/mol. Its IUPAC name is 2-amino-3-(3-aminobutanoylamino)propanoic acid.
| Compound Name | 2-amino-3-(3-aminobutanoylamino)propanoic acid |
|---|---|
| PubChem CID | 123589303 |
| Molecular Formula | C7H15N3O3 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.11 |
| IUPAC Name | 2-amino-3-(3-aminobutanoylamino)propanoic acid |
| SMILES | CC(N)CC(=O)NCC(N)C(=O)O |
| InChI | InChI=1S/C7H15N3O3/c1-4(8)2-6(11)10-3-5(9)7(12)13/h4-5H,2-3,8-9H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | OBMOKZAAUFIEOX-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |