C7H15N3O4 — CID 155095224
(2S)-2-amino-3-[(2-amino-3-hydroxybutanoyl)amino]propanoic acid (PubChem CID 155095224) has the molecular formula C7H15N3O4 and a molecular weight of 205.21 g/mol. Its IUPAC name is (2S)-2-amino-3-[(2-amino-3-hydroxybutanoyl)amino]propanoic acid.
| Compound Name | (2S)-2-amino-3-[(2-amino-3-hydroxybutanoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 155095224 |
| Molecular Formula | C7H15N3O4 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (2S)-2-amino-3-[(2-amino-3-hydroxybutanoyl)amino]propanoic acid |
| SMILES | CC(O)C(N)C(=O)NC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H15N3O4/c1-3(11)5(9)6(12)10-2-4(8)7(13)14/h3-5,11H,2,8-9H2,1H3,(H,10,12)(H,13,14)/t3?,4-,5?/m0/s1 |
| InChIKey | NWQFNEWWLOAWAB-QHWRUIEBSA-N |
| XLogP | -2.78 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |