2-amino-3-hydrazinylpropanoic acid

C3H9N3O2 — CID 155021010

IUPAC2-amino-3-hydrazinylpropanoic acid
SMILESNNCC(N)C(=O)O
InChIInChI=1S/C3H9N3O2/c4-2(1-6-5)3(7)8/h2,6H,1,4-5H2,(H,7,8)
InChIKeyNARWWUXPDFIQTL-UHFFFAOYSA-N
MW119.12 g/mol
LogP-2.14
Rot. Bonds3

About 2-amino-3-hydrazinylpropanoic acid

2-amino-3-hydrazinylpropanoic acid (PubChem CID 155021010) has the molecular formula C3H9N3O2 and a molecular weight of 119.12 g/mol. Its IUPAC name is 2-amino-3-hydrazinylpropanoic acid.

Molecular Properties

Compound Name2-amino-3-hydrazinylpropanoic acid
PubChem CID155021010
Molecular FormulaC3H9N3O2
Molecular Weight119.12 g/mol
Exact Mass119.07
IUPAC Name2-amino-3-hydrazinylpropanoic acid
SMILESNNCC(N)C(=O)O
InChIInChI=1S/C3H9N3O2/c4-2(1-6-5)3(7)8/h2,6H,1,4-5H2,(H,7,8)
InChIKeyNARWWUXPDFIQTL-UHFFFAOYSA-N
XLogP-2.14
TPSA101.37 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500119.12
LogP ≤ 5-2.14
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-amino-3-hydrazinylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2S)-2-amino-3-(2-aminohydrazinyl)propanoic acid
CID 146672991
(2S)-2-amino-3-(carbamoylamino)propanoic acid;hydrochloride
CID 24854389
2-amino-3-(1-hydroxyethylamino)propanoic acid
CID 130791522
2-amino-3-(2,2-dimethylhydrazinyl)propanoic acid
CID 83024526
2-amino-3-[(2-aminoacetyl)amino]propanoic acid
CID 14721793
(2S,5S)-2,5-diaminohexanedioic acid
CID 22871875
2-amino-3-(propanoylamino)propanoic acid
CID 59142099
2-amino-3-(trideuteriomethylamino)propanoic acid;hydrochloride
CID 71313292
2,3-diaminopropanoic acid
CID 160927094
(2S)-2-amino-3-hydroxy(1,2,3-13C3)propanoic acid
CID 71309922
2-amino-3-deuteriobutanedioic acid
CID 119075971
(2S)-2-amino-3-(3-methylbutanoylamino)propanoic acid
CID 169059714

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-hydrazinylpropanoic acid?
The IUPAC name of 2-amino-3-hydrazinylpropanoic acid (CID 155021010) is 2-amino-3-hydrazinylpropanoic acid.
What is the SMILES notation for 2-amino-3-hydrazinylpropanoic acid?
The canonical SMILES for 2-amino-3-hydrazinylpropanoic acid is NNCC(N)C(=O)O.
What is the InChIKey of 2-amino-3-hydrazinylpropanoic acid?
The InChIKey is NARWWUXPDFIQTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N3O2/c4-2(1-6-5)3(7)8/h2,6H,1,4-5H2,(H,7,8).
What are the key properties of 2-amino-3-hydrazinylpropanoic acid?
2-amino-3-hydrazinylpropanoic acid has a molecular weight of 119.12 g/mol, XLogP of -2.14, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-hydrazinylpropanoic acid is sourced from PubChem (CID 155021010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).