2-amino-3-(2,2-dimethylhydrazinyl)propanoic acid

C5H13N3O2 — CID 83024526

IUPAC2-amino-3-(2,2-dimethylhydrazinyl)propanoic acid
SMILESCN(C)NCC(N)C(=O)O
InChIInChI=1S/C5H13N3O2/c1-8(2)7-3-4(6)5(9)10/h4,7H,3,6H2,1-2H3,(H,9,10)
InChIKeyYOHLKOGUNSWFKZ-UHFFFAOYSA-N
MW147.18 g/mol
LogP-1.54
Rot. Bonds4

About 2-amino-3-(2,2-dimethylhydrazinyl)propanoic acid

2-amino-3-(2,2-dimethylhydrazinyl)propanoic acid (PubChem CID 83024526) has the molecular formula C5H13N3O2 and a molecular weight of 147.18 g/mol. Its IUPAC name is 2-amino-3-(2,2-dimethylhydrazinyl)propanoic acid.

Molecular Properties

Compound Name2-amino-3-(2,2-dimethylhydrazinyl)propanoic acid
PubChem CID83024526
Molecular FormulaC5H13N3O2
Molecular Weight147.18 g/mol
Exact Mass147.10
IUPAC Name2-amino-3-(2,2-dimethylhydrazinyl)propanoic acid
SMILESCN(C)NCC(N)C(=O)O
InChIInChI=1S/C5H13N3O2/c1-8(2)7-3-4(6)5(9)10/h4,7H,3,6H2,1-2H3,(H,9,10)
InChIKeyYOHLKOGUNSWFKZ-UHFFFAOYSA-N
XLogP-1.54
TPSA78.59 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500147.18
LogP ≤ 5-1.54
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-amino-3-(2,2-dimethylhydrazinyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-(2,2-dimethylhydrazinyl)propanoic acid?
The IUPAC name of 2-amino-3-(2,2-dimethylhydrazinyl)propanoic acid (CID 83024526) is 2-amino-3-(2,2-dimethylhydrazinyl)propanoic acid.
What is the SMILES notation for 2-amino-3-(2,2-dimethylhydrazinyl)propanoic acid?
The canonical SMILES for 2-amino-3-(2,2-dimethylhydrazinyl)propanoic acid is CN(C)NCC(N)C(=O)O.
What is the InChIKey of 2-amino-3-(2,2-dimethylhydrazinyl)propanoic acid?
The InChIKey is YOHLKOGUNSWFKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3O2/c1-8(2)7-3-4(6)5(9)10/h4,7H,3,6H2,1-2H3,(H,9,10).
What are the key properties of 2-amino-3-(2,2-dimethylhydrazinyl)propanoic acid?
2-amino-3-(2,2-dimethylhydrazinyl)propanoic acid has a molecular weight of 147.18 g/mol, XLogP of -1.54, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(2,2-dimethylhydrazinyl)propanoic acid is sourced from PubChem (CID 83024526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).