C5H13N3O2 — CID 83024526
2-amino-3-(2,2-dimethylhydrazinyl)propanoic acid (PubChem CID 83024526) has the molecular formula C5H13N3O2 and a molecular weight of 147.18 g/mol. Its IUPAC name is 2-amino-3-(2,2-dimethylhydrazinyl)propanoic acid.
| Compound Name | 2-amino-3-(2,2-dimethylhydrazinyl)propanoic acid |
|---|---|
| PubChem CID | 83024526 |
| Molecular Formula | C5H13N3O2 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 2-amino-3-(2,2-dimethylhydrazinyl)propanoic acid |
| SMILES | CN(C)NCC(N)C(=O)O |
| InChI | InChI=1S/C5H13N3O2/c1-8(2)7-3-4(6)5(9)10/h4,7H,3,6H2,1-2H3,(H,9,10) |
| InChIKey | YOHLKOGUNSWFKZ-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|