(2S)-2-amino-3-(2-aminohydrazinyl)propanoic acid

C3H10N4O2 — CID 146672991

IUPAC(2S)-2-amino-3-(2-aminohydrazinyl)propanoic acid
SMILESNNNC[C@H](N)C(=O)O
InChIInChI=1S/C3H10N4O2/c4-2(3(8)9)1-6-7-5/h2,6-7H,1,4-5H2,(H,8,9)/t2-/m0/s1
InChIKeyCPNWKFOHPKABKD-REOHCLBHSA-N
MW134.14 g/mol
LogP-2.63
Rot. Bonds4

About (2S)-2-amino-3-(2-aminohydrazinyl)propanoic acid

(2S)-2-amino-3-(2-aminohydrazinyl)propanoic acid (PubChem CID 146672991) has the molecular formula C3H10N4O2 and a molecular weight of 134.14 g/mol. Its IUPAC name is (2S)-2-amino-3-(2-aminohydrazinyl)propanoic acid.

Molecular Properties

Compound Name(2S)-2-amino-3-(2-aminohydrazinyl)propanoic acid
PubChem CID146672991
Molecular FormulaC3H10N4O2
Molecular Weight134.14 g/mol
Exact Mass134.08
IUPAC Name(2S)-2-amino-3-(2-aminohydrazinyl)propanoic acid
SMILESNNNC[C@H](N)C(=O)O
InChIInChI=1S/C3H10N4O2/c4-2(3(8)9)1-6-7-5/h2,6-7H,1,4-5H2,(H,8,9)/t2-/m0/s1
InChIKeyCPNWKFOHPKABKD-REOHCLBHSA-N
XLogP-2.63
TPSA113.40 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500134.14
LogP ≤ 5-2.63
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (2S)-2-amino-3-(2-aminohydrazinyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-amino-3-(2-aminohydrazinyl)propanoic acid?
The IUPAC name of (2S)-2-amino-3-(2-aminohydrazinyl)propanoic acid (CID 146672991) is (2S)-2-amino-3-(2-aminohydrazinyl)propanoic acid.
What is the SMILES notation for (2S)-2-amino-3-(2-aminohydrazinyl)propanoic acid?
The canonical SMILES for (2S)-2-amino-3-(2-aminohydrazinyl)propanoic acid is NNNC[C@H](N)C(=O)O.
What is the InChIKey of (2S)-2-amino-3-(2-aminohydrazinyl)propanoic acid?
The InChIKey is CPNWKFOHPKABKD-REOHCLBHSA-N. The full InChI is InChI=1S/C3H10N4O2/c4-2(3(8)9)1-6-7-5/h2,6-7H,1,4-5H2,(H,8,9)/t2-/m0/s1.
What are the key properties of (2S)-2-amino-3-(2-aminohydrazinyl)propanoic acid?
(2S)-2-amino-3-(2-aminohydrazinyl)propanoic acid has a molecular weight of 134.14 g/mol, XLogP of -2.63, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-(2-aminohydrazinyl)propanoic acid is sourced from PubChem (CID 146672991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).