C4H11ClN2O2 — CID 71313292
2-amino-3-(trideuteriomethylamino)propanoic acid;hydrochloride (PubChem CID 71313292) has the molecular formula C4H11ClN2O2 and a molecular weight of 157.62 g/mol. Its IUPAC name is 2-amino-3-(trideuteriomethylamino)propanoic acid;hydrochloride.
| Compound Name | 2-amino-3-(trideuteriomethylamino)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 71313292 |
| Molecular Formula | C4H11ClN2O2 |
| Molecular Weight | 157.62 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 2-amino-3-(trideuteriomethylamino)propanoic acid;hydrochloride |
| SMILES | Cl.[2H]C([2H])([2H])NCC(N)C(=O)O |
| InChI | InChI=1S/C4H10N2O2.ClH/c1-6-2-3(5)4(7)8;/h3,6H,2,5H2,1H3,(H,7,8);1H/i1D3; |
| InChIKey | VDXYGASOGLSIDM-NIIDSAIPSA-N |
| XLogP | -0.96 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.62 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |