C12H25N3O6 — CID 73069397
2-amino-6-[(5-amino-5-carboxy-2-hydroxypentyl)amino]-5-hydroxyhexanoic acid (PubChem CID 73069397) has the molecular formula C12H25N3O6 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-amino-6-[(5-amino-5-carboxy-2-hydroxypentyl)amino]-5-hydroxyhexanoic acid.
| Compound Name | 2-amino-6-[(5-amino-5-carboxy-2-hydroxypentyl)amino]-5-hydroxyhexanoic acid |
|---|---|
| PubChem CID | 73069397 |
| Molecular Formula | C12H25N3O6 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 2-amino-6-[(5-amino-5-carboxy-2-hydroxypentyl)amino]-5-hydroxyhexanoic acid |
| SMILES | NC(CCC(O)CNCC(O)CCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H25N3O6/c13-9(11(18)19)3-1-7(16)5-15-6-8(17)2-4-10(14)12(20)21/h7-10,15-17H,1-6,13-14H2,(H,18,19)(H,20,21) |
| InChIKey | COYAOJMPFAKKAM-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 179.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |