C6H14N2O3 — CID 123323181
(5S)-2,6-diamino-5-hydroxyhexanoic acid (PubChem CID 123323181) has the molecular formula C6H14N2O3 and a molecular weight of 162.19 g/mol. Its IUPAC name is (5S)-2,6-diamino-5-hydroxyhexanoic acid.
| Compound Name | (5S)-2,6-diamino-5-hydroxyhexanoic acid |
|---|---|
| PubChem CID | 123323181 |
| Molecular Formula | C6H14N2O3 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (5S)-2,6-diamino-5-hydroxyhexanoic acid |
| SMILES | NC[C@@H](O)CCC(N)C(=O)O |
| InChI | InChI=1S/C6H14N2O3/c7-3-4(9)1-2-5(8)6(10)11/h4-5,9H,1-3,7-8H2,(H,10,11)/t4-,5?/m0/s1 |
| InChIKey | YSMODUONRAFBET-ROLXFIACSA-N |
| XLogP | -1.50 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |