About 2,6-diamino-5-hydroxyhexanoic acid;pyrrolidine-2-carboxylic acid
2,6-diamino-5-hydroxyhexanoic acid;pyrrolidine-2-carboxylic acid (PubChem CID 22099142) has the molecular formula C11H23N3O5
and a molecular weight of 277.32 g/mol. Its IUPAC name is 2,6-diamino-5-hydroxyhexanoic acid;pyrrolidine-2-carboxylic acid.
Analyze 2,6-diamino-5-hydroxyhexanoic acid;pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diamino-5-hydroxyhexanoic acid;pyrrolidine-2-carboxylic acid?
The IUPAC name of 2,6-diamino-5-hydroxyhexanoic acid;pyrrolidine-2-carboxylic acid (CID 22099142) is 2,6-diamino-5-hydroxyhexanoic acid;pyrrolidine-2-carboxylic acid.
What is the SMILES notation for 2,6-diamino-5-hydroxyhexanoic acid;pyrrolidine-2-carboxylic acid?
The canonical SMILES for 2,6-diamino-5-hydroxyhexanoic acid;pyrrolidine-2-carboxylic acid is NCC(O)CCC(N)C(=O)O.O=C(O)C1CCCN1.
What is the InChIKey of 2,6-diamino-5-hydroxyhexanoic acid;pyrrolidine-2-carboxylic acid?
The InChIKey is KBHMHMREYZMUMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O3.C5H9NO2/c7-3-4(9)1-2-5(8)6(10)11;7-5(8)4-2-1-3-6-4/h4-5,9H,1-3,7-8H2,(H,10,11);4,6H,1-3H2,(H,7,8).
What are the key properties of 2,6-diamino-5-hydroxyhexanoic acid;pyrrolidine-2-carboxylic acid?
2,6-diamino-5-hydroxyhexanoic acid;pyrrolidine-2-carboxylic acid has a molecular weight of 277.32 g/mol, XLogP of -1.68, 6 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diamino-5-hydroxyhexanoic acid;pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 22099142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).