C17H37N9O6 — CID 118395312
bis((2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid);(2S)-pyrrolidine-2-carboxylic acid (PubChem CID 118395312) has the molecular formula C17H37N9O6 and a molecular weight of 463.54 g/mol. Its IUPAC name is bis((2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid);(2S)-pyrrolidine-2-carboxylic acid.
| Compound Name | bis((2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid);(2S)-pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 118395312 |
| Molecular Formula | C17H37N9O6 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | bis((2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid);(2S)-pyrrolidine-2-carboxylic acid |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)O.NC(N)=NCCC[C@H](N)C(=O)O.O=C(O)[C@@H]1CCCN1 |
| InChI | InChI=1S/2C6H14N4O2.C5H9NO2/c2*7-4(5(11)12)2-1-3-10-6(8)9;7-5(8)4-2-1-3-6-4/h2*4H,1-3,7H2,(H,11,12)(H4,8,9,10);4,6H,1-3H2,(H,7,8)/t3*4-/m000/s1 |
| InChIKey | SAFZWQVQHDBNGV-MOBQZEGBSA-N |
| XLogP | -3.27 |
| TPSA | 304.77 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|