C14H30N4O6 — CID 20598904
(2S)-2-aminopropanoic acid;(2S)-2,6-diaminohexanoic acid;(2S)-pyrrolidine-2-carboxylic acid (PubChem CID 20598904) has the molecular formula C14H30N4O6 and a molecular weight of 350.42 g/mol. Its IUPAC name is (2S)-2-aminopropanoic acid;(2S)-2,6-diaminohexanoic acid;(2S)-pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-2-aminopropanoic acid;(2S)-2,6-diaminohexanoic acid;(2S)-pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 20598904 |
| Molecular Formula | C14H30N4O6 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | (2S)-2-aminopropanoic acid;(2S)-2,6-diaminohexanoic acid;(2S)-pyrrolidine-2-carboxylic acid |
| SMILES | C[C@H](N)C(=O)O.NCCCC[C@H](N)C(=O)O.O=C(O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C6H14N2O2.C5H9NO2.C3H7NO2/c7-4-2-1-3-5(8)6(9)10;7-5(8)4-2-1-3-6-4;1-2(4)3(5)6/h5H,1-4,7-8H2,(H,9,10);4,6H,1-3H2,(H,7,8);2H,4H2,1H3,(H,5,6)/t5-;4-;2-/m000/s1 |
| InChIKey | ULBOLDVMVFNCFL-VCIZMDRUSA-N |
| XLogP | -1.23 |
| TPSA | 201.99 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|