C8H18BN2O6 — CID 67175874
CID 67175874 (PubChem CID 67175874) has the molecular formula C8H18BN2O6 and a molecular weight of 249.05 g/mol.
| Compound Name | CID 67175874 |
|---|---|
| PubChem CID | 67175874 |
| Molecular Formula | C8H18BN2O6 |
| Molecular Weight | 249.05 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | — |
| SMILES | C[C@H](N)C(=O)O.O=C(O)[C@@H]1CCCN1.O[B]O |
| InChI | InChI=1S/C5H9NO2.C3H7NO2.BH2O2/c7-5(8)4-2-1-3-6-4;1-2(4)3(5)6;2-1-3/h4,6H,1-3H2,(H,7,8);2H,4H2,1H3,(H,5,6);2-3H/t4-;2-;/m00./s1 |
| InChIKey | MWVFIWTWYVEDJK-WSTBAARBSA-N |
| XLogP | -2.25 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.05 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|