C11H22N2O4 — CID 66790467
(2S)-2-amino-4-methylpentanoic acid;(2S)-pyrrolidine-2-carboxylic acid (PubChem CID 66790467) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is (2S)-2-amino-4-methylpentanoic acid;(2S)-pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-2-amino-4-methylpentanoic acid;(2S)-pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 66790467 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (2S)-2-amino-4-methylpentanoic acid;(2S)-pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)C[C@H](N)C(=O)O.O=C(O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C6H13NO2.C5H9NO2/c1-4(2)3-5(7)6(8)9;7-5(8)4-2-1-3-6-4/h4-5H,3,7H2,1-2H3,(H,8,9);4,6H,1-3H2,(H,7,8)/t5-;4-/m00/s1 |
| InChIKey | RVGWDXKWRWBDJG-VDQHJUMDSA-N |
| XLogP | 0.27 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |