C10H20N2O4S — CID 141203055
(2R)-2-amino-4-methylsulfanylbutanoic acid;(2R)-pyrrolidine-2-carboxylic acid (PubChem CID 141203055) has the molecular formula C10H20N2O4S and a molecular weight of 264.35 g/mol. Its IUPAC name is (2R)-2-amino-4-methylsulfanylbutanoic acid;(2R)-pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-2-amino-4-methylsulfanylbutanoic acid;(2R)-pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 141203055 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | (2R)-2-amino-4-methylsulfanylbutanoic acid;(2R)-pyrrolidine-2-carboxylic acid |
| SMILES | CSCC[C@@H](N)C(=O)O.O=C(O)[C@H]1CCCN1 |
| InChI | InChI=1S/C5H11NO2S.C5H9NO2/c1-9-3-2-4(6)5(7)8;7-5(8)4-2-1-3-6-4/h4H,2-3,6H2,1H3,(H,7,8);4,6H,1-3H2,(H,7,8)/t2*4-/m11/s1 |
| InChIKey | PDMBMVZGASWJBZ-DGPROHSZSA-N |
| XLogP | -0.03 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |