C16H32N4O6 — CID 161069597
(2S)-2,6-diaminohexanoic acid;bis((2S)-pyrrolidine-2-carboxylic acid) (PubChem CID 161069597) has the molecular formula C16H32N4O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoic acid;bis((2S)-pyrrolidine-2-carboxylic acid).
| Compound Name | (2S)-2,6-diaminohexanoic acid;bis((2S)-pyrrolidine-2-carboxylic acid) |
|---|---|
| PubChem CID | 161069597 |
| Molecular Formula | C16H32N4O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;bis((2S)-pyrrolidine-2-carboxylic acid) |
| SMILES | NCCCC[C@H](N)C(=O)O.O=C(O)[C@@H]1CCCN1.O=C(O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C6H14N2O2.2C5H9NO2/c7-4-2-1-3-5(8)6(9)10;2*7-5(8)4-2-1-3-6-4/h5H,1-4,7-8H2,(H,9,10);2*4,6H,1-3H2,(H,7,8)/t5-;2*4-/m000/s1 |
| InChIKey | UEMBRZTUCSBCAK-ZPDHUDNGSA-N |
| XLogP | -0.83 |
| TPSA | 188.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|