argon;(2S)-pyrrolidine-2-carboxylic acid

C5H9ArNO2 — CID 160825816

IUPACargon;(2S)-pyrrolidine-2-carboxylic acid
SMILESO=C(O)[C@@H]1CCCN1.[Ar]
InChIInChI=1S/C5H9NO2.Ar/c7-5(8)4-2-1-3-6-4;/h4,6H,1-3H2,(H,7,8);/t4-;/m0./s1
InChIKeySGDMJAFJRNWNTN-WCCKRBBISA-N
MW155.08 g/mol
LogP-0.18
Rot. Bonds1

About argon;(2S)-pyrrolidine-2-carboxylic acid

argon;(2S)-pyrrolidine-2-carboxylic acid (PubChem CID 160825816) has the molecular formula C5H9ArNO2 and a molecular weight of 155.08 g/mol. Its IUPAC name is argon;(2S)-pyrrolidine-2-carboxylic acid.

Molecular Properties

Compound Nameargon;(2S)-pyrrolidine-2-carboxylic acid
PubChem CID160825816
Molecular FormulaC5H9ArNO2
Molecular Weight155.08 g/mol
Exact Mass155.03
IUPAC Nameargon;(2S)-pyrrolidine-2-carboxylic acid
SMILESO=C(O)[C@@H]1CCCN1.[Ar]
InChIInChI=1S/C5H9NO2.Ar/c7-5(8)4-2-1-3-6-4;/h4,6H,1-3H2,(H,7,8);/t4-;/m0./s1
InChIKeySGDMJAFJRNWNTN-WCCKRBBISA-N
XLogP-0.18
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500155.08
LogP ≤ 5-0.18
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze argon;(2S)-pyrrolidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of argon;(2S)-pyrrolidine-2-carboxylic acid?
The IUPAC name of argon;(2S)-pyrrolidine-2-carboxylic acid (CID 160825816) is argon;(2S)-pyrrolidine-2-carboxylic acid.
What is the SMILES notation for argon;(2S)-pyrrolidine-2-carboxylic acid?
The canonical SMILES for argon;(2S)-pyrrolidine-2-carboxylic acid is O=C(O)[C@@H]1CCCN1.[Ar].
What is the InChIKey of argon;(2S)-pyrrolidine-2-carboxylic acid?
The InChIKey is SGDMJAFJRNWNTN-WCCKRBBISA-N. The full InChI is InChI=1S/C5H9NO2.Ar/c7-5(8)4-2-1-3-6-4;/h4,6H,1-3H2,(H,7,8);/t4-;/m0./s1.
What are the key properties of argon;(2S)-pyrrolidine-2-carboxylic acid?
argon;(2S)-pyrrolidine-2-carboxylic acid has a molecular weight of 155.08 g/mol, XLogP of -0.18, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for argon;(2S)-pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 160825816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).