About argon;(2S)-pyrrolidine-2-carboxylic acid
argon;(2S)-pyrrolidine-2-carboxylic acid (PubChem CID 160825816) has the molecular formula C5H9ArNO2
and a molecular weight of 155.08 g/mol. Its IUPAC name is argon;(2S)-pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | argon;(2S)-pyrrolidine-2-carboxylic acid |
| PubChem CID | 160825816 |
| Molecular Formula | C5H9ArNO2 |
| Molecular Weight | 155.08 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | argon;(2S)-pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1.[Ar] |
| InChI | InChI=1S/C5H9NO2.Ar/c7-5(8)4-2-1-3-6-4;/h4,6H,1-3H2,(H,7,8);/t4-;/m0./s1 |
| InChIKey | SGDMJAFJRNWNTN-WCCKRBBISA-N |
| XLogP | -0.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.08 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze argon;(2S)-pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of argon;(2S)-pyrrolidine-2-carboxylic acid?
The IUPAC name of argon;(2S)-pyrrolidine-2-carboxylic acid (CID 160825816) is argon;(2S)-pyrrolidine-2-carboxylic acid.
What is the SMILES notation for argon;(2S)-pyrrolidine-2-carboxylic acid?
The canonical SMILES for argon;(2S)-pyrrolidine-2-carboxylic acid is O=C(O)[C@@H]1CCCN1.[Ar].
What is the InChIKey of argon;(2S)-pyrrolidine-2-carboxylic acid?
The InChIKey is SGDMJAFJRNWNTN-WCCKRBBISA-N. The full InChI is InChI=1S/C5H9NO2.Ar/c7-5(8)4-2-1-3-6-4;/h4,6H,1-3H2,(H,7,8);/t4-;/m0./s1.
What are the key properties of argon;(2S)-pyrrolidine-2-carboxylic acid?
argon;(2S)-pyrrolidine-2-carboxylic acid has a molecular weight of 155.08 g/mol, XLogP of -0.18, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for argon;(2S)-pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 160825816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).