About pyrrolidine-2-carboxylic acid;yttrium
pyrrolidine-2-carboxylic acid;yttrium (PubChem CID 21344974) has the molecular formula C5H9NO2Y
and a molecular weight of 204.04 g/mol. Its IUPAC name is pyrrolidine-2-carboxylic acid;yttrium.
Molecular Properties
| Compound Name | pyrrolidine-2-carboxylic acid;yttrium |
| PubChem CID | 21344974 |
| Molecular Formula | C5H9NO2Y |
| Molecular Weight | 204.04 g/mol |
| Exact Mass | 203.97 |
| IUPAC Name | pyrrolidine-2-carboxylic acid;yttrium |
| SMILES | O=C(O)C1CCCN1.[Y] |
| InChI | InChI=1S/C5H9NO2.Y/c7-5(8)4-2-1-3-6-4;/h4,6H,1-3H2,(H,7,8); |
| InChIKey | BURYOQODBPRMAH-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.04 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pyrrolidine-2-carboxylic acid;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidine-2-carboxylic acid;yttrium?
The IUPAC name of pyrrolidine-2-carboxylic acid;yttrium (CID 21344974) is pyrrolidine-2-carboxylic acid;yttrium.
What is the SMILES notation for pyrrolidine-2-carboxylic acid;yttrium?
The canonical SMILES for pyrrolidine-2-carboxylic acid;yttrium is O=C(O)C1CCCN1.[Y].
What is the InChIKey of pyrrolidine-2-carboxylic acid;yttrium?
The InChIKey is BURYOQODBPRMAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2.Y/c7-5(8)4-2-1-3-6-4;/h4,6H,1-3H2,(H,7,8);.
What are the key properties of pyrrolidine-2-carboxylic acid;yttrium?
pyrrolidine-2-carboxylic acid;yttrium has a molecular weight of 204.04 g/mol, XLogP of -0.18, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidine-2-carboxylic acid;yttrium is sourced from PubChem (CID 21344974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).