About bis((2S)-pyrrolidine-2-carboxylic acid);hydrate
bis((2S)-pyrrolidine-2-carboxylic acid);hydrate (PubChem CID 67110713) has the molecular formula C10H20N2O5
and a molecular weight of 248.28 g/mol. Its IUPAC name is bis((2S)-pyrrolidine-2-carboxylic acid);hydrate.
Molecular Properties
| Compound Name | bis((2S)-pyrrolidine-2-carboxylic acid);hydrate |
| PubChem CID | 67110713 |
| Molecular Formula | C10H20N2O5 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | bis((2S)-pyrrolidine-2-carboxylic acid);hydrate |
| SMILES | O.O=C(O)[C@@H]1CCCN1.O=C(O)[C@@H]1CCCN1 |
| InChI | InChI=1S/2C5H9NO2.H2O/c2*7-5(8)4-2-1-3-6-4;/h2*4,6H,1-3H2,(H,7,8);1H2/t2*4-;/m00./s1 |
| InChIKey | KBHZCYUMGZNWFB-SCGRZTRASA-N |
| XLogP | -1.18 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis((2S)-pyrrolidine-2-carboxylic acid);hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((2S)-pyrrolidine-2-carboxylic acid);hydrate?
The IUPAC name of bis((2S)-pyrrolidine-2-carboxylic acid);hydrate (CID 67110713) is bis((2S)-pyrrolidine-2-carboxylic acid);hydrate.
What is the SMILES notation for bis((2S)-pyrrolidine-2-carboxylic acid);hydrate?
The canonical SMILES for bis((2S)-pyrrolidine-2-carboxylic acid);hydrate is O.O=C(O)[C@@H]1CCCN1.O=C(O)[C@@H]1CCCN1.
What is the InChIKey of bis((2S)-pyrrolidine-2-carboxylic acid);hydrate?
The InChIKey is KBHZCYUMGZNWFB-SCGRZTRASA-N. The full InChI is InChI=1S/2C5H9NO2.H2O/c2*7-5(8)4-2-1-3-6-4;/h2*4,6H,1-3H2,(H,7,8);1H2/t2*4-;/m00./s1.
What are the key properties of bis((2S)-pyrrolidine-2-carboxylic acid);hydrate?
bis((2S)-pyrrolidine-2-carboxylic acid);hydrate has a molecular weight of 248.28 g/mol, XLogP of -1.18, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis((2S)-pyrrolidine-2-carboxylic acid);hydrate is sourced from PubChem (CID 67110713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).