About pyrrolidine-2-carboxylic acid;silver
pyrrolidine-2-carboxylic acid;silver (PubChem CID 87701112) has the molecular formula C5H9AgNO2
and a molecular weight of 223.00 g/mol. Its IUPAC name is pyrrolidine-2-carboxylic acid;silver.
Molecular Properties
| Compound Name | pyrrolidine-2-carboxylic acid;silver |
| PubChem CID | 87701112 |
| Molecular Formula | C5H9AgNO2 |
| Molecular Weight | 223.00 g/mol |
| Exact Mass | 221.97 |
| IUPAC Name | pyrrolidine-2-carboxylic acid;silver |
| SMILES | O=C(O)C1CCCN1.[Ag] |
| InChI | InChI=1S/C5H9NO2.Ag/c7-5(8)4-2-1-3-6-4;/h4,6H,1-3H2,(H,7,8); |
| InChIKey | VPRYXZDSQWJWLK-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.00 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pyrrolidine-2-carboxylic acid;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidine-2-carboxylic acid;silver?
The IUPAC name of pyrrolidine-2-carboxylic acid;silver (CID 87701112) is pyrrolidine-2-carboxylic acid;silver.
What is the SMILES notation for pyrrolidine-2-carboxylic acid;silver?
The canonical SMILES for pyrrolidine-2-carboxylic acid;silver is O=C(O)C1CCCN1.[Ag].
What is the InChIKey of pyrrolidine-2-carboxylic acid;silver?
The InChIKey is VPRYXZDSQWJWLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2.Ag/c7-5(8)4-2-1-3-6-4;/h4,6H,1-3H2,(H,7,8);.
What are the key properties of pyrrolidine-2-carboxylic acid;silver?
pyrrolidine-2-carboxylic acid;silver has a molecular weight of 223.00 g/mol, XLogP of -0.18, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidine-2-carboxylic acid;silver is sourced from PubChem (CID 87701112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).