About carbonic acid;(2S)-pyrrolidine-2-carboxylic acid
carbonic acid;(2S)-pyrrolidine-2-carboxylic acid (PubChem CID 70552648) has the molecular formula C6H11NO5
and a molecular weight of 177.16 g/mol. Its IUPAC name is carbonic acid;(2S)-pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | carbonic acid;(2S)-pyrrolidine-2-carboxylic acid |
| PubChem CID | 70552648 |
| Molecular Formula | C6H11NO5 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | carbonic acid;(2S)-pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)O.O=C(O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C5H9NO2.CH2O3/c7-5(8)4-2-1-3-6-4;2-1(3)4/h4,6H,1-3H2,(H,7,8);(H2,2,3,4)/t4-;/m0./s1 |
| InChIKey | RTMFVGINWLBAQO-WCCKRBBISA-N |
| XLogP | 0.05 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze carbonic acid;(2S)-pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;(2S)-pyrrolidine-2-carboxylic acid?
The IUPAC name of carbonic acid;(2S)-pyrrolidine-2-carboxylic acid (CID 70552648) is carbonic acid;(2S)-pyrrolidine-2-carboxylic acid.
What is the SMILES notation for carbonic acid;(2S)-pyrrolidine-2-carboxylic acid?
The canonical SMILES for carbonic acid;(2S)-pyrrolidine-2-carboxylic acid is O=C(O)O.O=C(O)[C@@H]1CCCN1.
What is the InChIKey of carbonic acid;(2S)-pyrrolidine-2-carboxylic acid?
The InChIKey is RTMFVGINWLBAQO-WCCKRBBISA-N. The full InChI is InChI=1S/C5H9NO2.CH2O3/c7-5(8)4-2-1-3-6-4;2-1(3)4/h4,6H,1-3H2,(H,7,8);(H2,2,3,4)/t4-;/m0./s1.
What are the key properties of carbonic acid;(2S)-pyrrolidine-2-carboxylic acid?
carbonic acid;(2S)-pyrrolidine-2-carboxylic acid has a molecular weight of 177.16 g/mol, XLogP of 0.05, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;(2S)-pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 70552648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).