About sodium;pyrrolidine-2-carboxylic acid;chloride
sodium;pyrrolidine-2-carboxylic acid;chloride (PubChem CID 68997199) has the molecular formula C5H9ClNNaO2
and a molecular weight of 173.57 g/mol. Its IUPAC name is sodium;pyrrolidine-2-carboxylic acid;chloride.
Molecular Properties
| Compound Name | sodium;pyrrolidine-2-carboxylic acid;chloride |
| PubChem CID | 68997199 |
| Molecular Formula | C5H9ClNNaO2 |
| Molecular Weight | 173.57 g/mol |
| Exact Mass | 173.02 |
| IUPAC Name | sodium;pyrrolidine-2-carboxylic acid;chloride |
| SMILES | O=C(O)C1CCCN1.[Cl-].[Na+] |
| InChI | InChI=1S/C5H9NO2.ClH.Na/c7-5(8)4-2-1-3-6-4;;/h4,6H,1-3H2,(H,7,8);1H;/q;;+1/p-1 |
| InChIKey | JTPDRYGRGBHNRZ-UHFFFAOYSA-M |
| XLogP | -6.17 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.57 |
| LogP ≤ 5 | -6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;pyrrolidine-2-carboxylic acid;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;pyrrolidine-2-carboxylic acid;chloride?
The IUPAC name of sodium;pyrrolidine-2-carboxylic acid;chloride (CID 68997199) is sodium;pyrrolidine-2-carboxylic acid;chloride.
What is the SMILES notation for sodium;pyrrolidine-2-carboxylic acid;chloride?
The canonical SMILES for sodium;pyrrolidine-2-carboxylic acid;chloride is O=C(O)C1CCCN1.[Cl-].[Na+].
What is the InChIKey of sodium;pyrrolidine-2-carboxylic acid;chloride?
The InChIKey is JTPDRYGRGBHNRZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H9NO2.ClH.Na/c7-5(8)4-2-1-3-6-4;;/h4,6H,1-3H2,(H,7,8);1H;/q;;+1/p-1.
What are the key properties of sodium;pyrrolidine-2-carboxylic acid;chloride?
sodium;pyrrolidine-2-carboxylic acid;chloride has a molecular weight of 173.57 g/mol, XLogP of -6.17, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;pyrrolidine-2-carboxylic acid;chloride is sourced from PubChem (CID 68997199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).