About methanethiol;pyrrolidine-2-carboxylic acid
methanethiol;pyrrolidine-2-carboxylic acid (PubChem CID 156719137) has the molecular formula C6H13NO2S
and a molecular weight of 163.24 g/mol. Its IUPAC name is methanethiol;pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | methanethiol;pyrrolidine-2-carboxylic acid |
| PubChem CID | 156719137 |
| Molecular Formula | C6H13NO2S |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | methanethiol;pyrrolidine-2-carboxylic acid |
| SMILES | CS.O=C(O)C1CCCN1 |
| InChI | InChI=1S/C5H9NO2.CH4S/c7-5(8)4-2-1-3-6-4;1-2/h4,6H,1-3H2,(H,7,8);2H,1H3 |
| InChIKey | HEAUOVLMMKMUMO-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methanethiol;pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanethiol;pyrrolidine-2-carboxylic acid?
The IUPAC name of methanethiol;pyrrolidine-2-carboxylic acid (CID 156719137) is methanethiol;pyrrolidine-2-carboxylic acid.
What is the SMILES notation for methanethiol;pyrrolidine-2-carboxylic acid?
The canonical SMILES for methanethiol;pyrrolidine-2-carboxylic acid is CS.O=C(O)C1CCCN1.
What is the InChIKey of methanethiol;pyrrolidine-2-carboxylic acid?
The InChIKey is HEAUOVLMMKMUMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2.CH4S/c7-5(8)4-2-1-3-6-4;1-2/h4,6H,1-3H2,(H,7,8);2H,1H3.
What are the key properties of methanethiol;pyrrolidine-2-carboxylic acid?
methanethiol;pyrrolidine-2-carboxylic acid has a molecular weight of 163.24 g/mol, XLogP of 0.37, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanethiol;pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 156719137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).