C11H21N5O2 — CID 57286216
2-[(4S)-4-amino-5,6-dioxo-6-[(2S)-pyrrolidin-2-yl]hexyl]guanidine (PubChem CID 57286216) has the molecular formula C11H21N5O2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-[(4S)-4-amino-5,6-dioxo-6-[(2S)-pyrrolidin-2-yl]hexyl]guanidine.
| Compound Name | 2-[(4S)-4-amino-5,6-dioxo-6-[(2S)-pyrrolidin-2-yl]hexyl]guanidine |
|---|---|
| PubChem CID | 57286216 |
| Molecular Formula | C11H21N5O2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 2-[(4S)-4-amino-5,6-dioxo-6-[(2S)-pyrrolidin-2-yl]hexyl]guanidine |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)C(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C11H21N5O2/c12-7(3-1-6-16-11(13)14)9(17)10(18)8-4-2-5-15-8/h7-8,15H,1-6,12H2,(H4,13,14,16)/t7-,8-/m0/s1 |
| InChIKey | XXDYSSRPXWBQEG-YUMQZZPRSA-N |
| XLogP | -1.74 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|