C10H18N4O3 — CID 174904347
[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl] cyclopropanecarboxylate (PubChem CID 174904347) has the molecular formula C10H18N4O3 and a molecular weight of 242.28 g/mol. Its IUPAC name is [(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl] cyclopropanecarboxylate.
| Compound Name | [(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 174904347 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | [(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl] cyclopropanecarboxylate |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)OC(=O)C1CC1 |
| InChI | InChI=1S/C10H18N4O3/c11-7(2-1-5-14-10(12)13)9(16)17-8(15)6-3-4-6/h6-7H,1-5,11H2,(H4,12,13,14)/t7-/m0/s1 |
| InChIKey | IDXDMOUTFBRZRE-ZETCQYMHSA-N |
| XLogP | -1.15 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|