C12H21N5O8 — CID 174478330
1-O-(2-aminoacetyl) 4-O-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl] 2,3-dihydroxybutanedioate (PubChem CID 174478330) has the molecular formula C12H21N5O8 and a molecular weight of 363.33 g/mol. Its IUPAC name is 1-O-(2-aminoacetyl) 4-O-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl] 2,3-dihydroxybutanedioate.
| Compound Name | 1-O-(2-aminoacetyl) 4-O-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl] 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 174478330 |
| Molecular Formula | C12H21N5O8 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 1-O-(2-aminoacetyl) 4-O-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl] 2,3-dihydroxybutanedioate |
| SMILES | NCC(=O)OC(=O)C(O)C(O)C(=O)OC(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C12H21N5O8/c13-4-6(18)24-10(22)7(19)8(20)11(23)25-9(21)5(14)2-1-3-17-12(15)16/h5,7-8,19-20H,1-4,13-14H2,(H4,15,16,17)/t5-,7?,8?/m0/s1 |
| InChIKey | CVZHQZZBZKNKNJ-JADALISFSA-N |
| XLogP | -4.81 |
| TPSA | 243.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | -4.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|