C14H28N4O3 — CID 57060583
[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl] octanoate (PubChem CID 57060583) has the molecular formula C14H28N4O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is [(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl] octanoate.
| Compound Name | [(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl] octanoate |
|---|---|
| PubChem CID | 57060583 |
| Molecular Formula | C14H28N4O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | [(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl] octanoate |
| SMILES | CCCCCCCC(=O)OC(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C14H28N4O3/c1-2-3-4-5-6-9-12(19)21-13(20)11(15)8-7-10-18-14(16)17/h11H,2-10,15H2,1H3,(H4,16,17,18)/t11-/m0/s1 |
| InChIKey | GBXSDPOBICMZTH-NSHDSACASA-N |
| XLogP | 0.80 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|