C19H40Cl2N4O5 — CID 11751870
[3-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxy-2-hydroxypropyl] decanoate;dihydrochloride (PubChem CID 11751870) has the molecular formula C19H40Cl2N4O5 and a molecular weight of 475.46 g/mol. Its IUPAC name is [3-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxy-2-hydroxypropyl] decanoate;dihydrochloride.
| Compound Name | [3-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxy-2-hydroxypropyl] decanoate;dihydrochloride |
|---|---|
| PubChem CID | 11751870 |
| Molecular Formula | C19H40Cl2N4O5 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | [3-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxy-2-hydroxypropyl] decanoate;dihydrochloride |
| SMILES | CCCCCCCCCC(=O)OCC(O)COC(=O)[C@@H](N)CCCN=C(N)N.Cl.Cl |
| InChI | InChI=1S/C19H38N4O5.2ClH/c1-2-3-4-5-6-7-8-11-17(25)27-13-15(24)14-28-18(26)16(20)10-9-12-23-19(21)22;;/h15-16,24H,2-14,20H2,1H3,(H4,21,22,23);2*1H/t15?,16-;;/m0../s1 |
| InChIKey | CSKIDOYVTNKAAK-AWESVXIMSA-N |
| XLogP | 1.80 |
| TPSA | 163.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|