C19H38N4O5 — CID 101365740
[(2S)-3-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxy-2-hydroxypropyl] decanoate (PubChem CID 101365740) has the molecular formula C19H38N4O5 and a molecular weight of 402.54 g/mol. Its IUPAC name is [(2S)-3-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxy-2-hydroxypropyl] decanoate.
| Compound Name | [(2S)-3-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxy-2-hydroxypropyl] decanoate |
|---|---|
| PubChem CID | 101365740 |
| Molecular Formula | C19H38N4O5 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | [(2S)-3-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxy-2-hydroxypropyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC[C@H](O)COC(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C19H38N4O5/c1-2-3-4-5-6-7-8-11-17(25)27-13-15(24)14-28-18(26)16(20)10-9-12-23-19(21)22/h15-16,24H,2-14,20H2,1H3,(H4,21,22,23)/t15-,16-/m0/s1 |
| InChIKey | SHVONLDAGIKNPC-HOTGVXAUSA-N |
| XLogP | 0.96 |
| TPSA | 163.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|