C7H17N5O2 — CID 139681753
aminomethyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate (PubChem CID 139681753) has the molecular formula C7H17N5O2 and a molecular weight of 203.25 g/mol. Its IUPAC name is aminomethyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate.
| Compound Name | aminomethyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 139681753 |
| Molecular Formula | C7H17N5O2 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | aminomethyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
| SMILES | NCOC(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C7H17N5O2/c8-4-14-6(13)5(9)2-1-3-12-7(10)11/h5H,1-4,8-9H2,(H4,10,11,12)/t5-/m0/s1 |
| InChIKey | MPMABMORQMPSSN-YFKPBYRVSA-N |
| XLogP | -2.17 |
| TPSA | 142.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|