C18H25Cl2N5O3 — CID 57002924
[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl] (2R)-1-[(3,5-dichlorophenyl)methyl]pyrrolidine-2-carboxylate (PubChem CID 57002924) has the molecular formula C18H25Cl2N5O3 and a molecular weight of 430.34 g/mol. Its IUPAC name is [(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl] (2R)-1-[(3,5-dichlorophenyl)methyl]pyrrolidine-2-carboxylate.
| Compound Name | [(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl] (2R)-1-[(3,5-dichlorophenyl)methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 57002924 |
| Molecular Formula | C18H25Cl2N5O3 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | [(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl] (2R)-1-[(3,5-dichlorophenyl)methyl]pyrrolidine-2-carboxylate |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)OC(=O)[C@H]1CCCN1Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H25Cl2N5O3/c19-12-7-11(8-13(20)9-12)10-25-6-2-4-15(25)17(27)28-16(26)14(21)3-1-5-24-18(22)23/h7-9,14-15H,1-6,10,21H2,(H4,22,23,24)/t14-,15+/m0/s1 |
| InChIKey | PUSCKTZNSMBZNG-LSDHHAIUSA-N |
| XLogP | 1.41 |
| TPSA | 137.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|