C13H16Cl2N4O — CID 54174342
N-(diaminomethylidene)-1-[(3,4-dichlorophenyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 54174342) has the molecular formula C13H16Cl2N4O and a molecular weight of 315.20 g/mol. Its IUPAC name is N-(diaminomethylidene)-1-[(3,4-dichlorophenyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | N-(diaminomethylidene)-1-[(3,4-dichlorophenyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 54174342 |
| Molecular Formula | C13H16Cl2N4O |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | N-(diaminomethylidene)-1-[(3,4-dichlorophenyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | NC(N)=NC(=O)C1CCCN1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H16Cl2N4O/c14-9-4-3-8(6-10(9)15)7-19-5-1-2-11(19)12(20)18-13(16)17/h3-4,6,11H,1-2,5,7H2,(H4,16,17,18,20) |
| InChIKey | OXEUUNBDJNQABY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|