C13H15Cl2NO2 — CID 51441049
(2S)-1-[(3,4-dichlorophenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 51441049) has the molecular formula C13H15Cl2NO2 and a molecular weight of 288.17 g/mol. Its IUPAC name is (2S)-1-[(3,4-dichlorophenyl)methyl]piperidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(3,4-dichlorophenyl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 51441049 |
| Molecular Formula | C13H15Cl2NO2 |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | (2S)-1-[(3,4-dichlorophenyl)methyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCCN1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2NO2/c14-10-5-4-9(7-11(10)15)8-16-6-2-1-3-12(16)13(17)18/h4-5,7,12H,1-3,6,8H2,(H,17,18)/t12-/m0/s1 |
| InChIKey | HNFZZWDLBBNCMH-LBPRGKRZSA-N |
| XLogP | 3.43 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |