C13H17NO3 — CID 65054111
1-[(3-hydroxyphenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 65054111) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 1-[(3-hydroxyphenyl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(3-hydroxyphenyl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 65054111 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 1-[(3-hydroxyphenyl)methyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1Cc1cccc(O)c1 |
| InChI | InChI=1S/C13H17NO3/c15-11-5-3-4-10(8-11)9-14-7-2-1-6-12(14)13(16)17/h3-5,8,12,15H,1-2,6-7,9H2,(H,16,17) |
| InChIKey | NIXOQFMMZMMZNL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |