C11H22N6O2 — CID 84951908
1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxamide (PubChem CID 84951908) has the molecular formula C11H22N6O2 and a molecular weight of 270.34 g/mol. Its IUPAC name is 1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 84951908 |
| Molecular Formula | C11H22N6O2 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1C(=O)C(N)CCCN=C(N)N |
| InChI | InChI=1S/C11H22N6O2/c12-7(3-1-5-16-11(14)15)10(19)17-6-2-4-8(17)9(13)18/h7-8H,1-6,12H2,(H2,13,18)(H4,14,15,16) |
| InChIKey | GDWPHSRBYNSAAI-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 153.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|