C8H15N5O2 — CID 139333846
2-[(4S)-4-amino-5-oxo-5-(3-oxoaziridin-2-yl)pentyl]guanidine (PubChem CID 139333846) has the molecular formula C8H15N5O2 and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-[(4S)-4-amino-5-oxo-5-(3-oxoaziridin-2-yl)pentyl]guanidine.
| Compound Name | 2-[(4S)-4-amino-5-oxo-5-(3-oxoaziridin-2-yl)pentyl]guanidine |
|---|---|
| PubChem CID | 139333846 |
| Molecular Formula | C8H15N5O2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 2-[(4S)-4-amino-5-oxo-5-(3-oxoaziridin-2-yl)pentyl]guanidine |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)C1NC1=O |
| InChI | InChI=1S/C8H15N5O2/c9-4(2-1-3-12-8(10)11)6(14)5-7(15)13-5/h4-5H,1-3,9H2,(H,13,15)(H4,10,11,12)/t4-,5?/m0/s1 |
| InChIKey | AFXUKNSQLRGUOV-ROLXFIACSA-N |
| XLogP | -2.57 |
| TPSA | 146.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|