C16H19N3O2S — CID 2175554
N-(4-butoxyphenyl)-2-pyrimidin-2-ylsulfanylacetamide (PubChem CID 2175554) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-2-pyrimidin-2-ylsulfanylacetamide.
| Compound Name | N-(4-butoxyphenyl)-2-pyrimidin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 2175554 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-(4-butoxyphenyl)-2-pyrimidin-2-ylsulfanylacetamide |
| SMILES | CCCCOc1ccc(NC(=O)CSc2ncccn2)cc1 |
| InChI | InChI=1S/C16H19N3O2S/c1-2-3-11-21-14-7-5-13(6-8-14)19-15(20)12-22-16-17-9-4-10-18-16/h4-10H,2-3,11-12H2,1H3,(H,19,20) |
| InChIKey | DYJWGYNFUWQEOC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|