C7H8ClN3OS — CID 130489954
2-(6-chloropyrimidin-4-yl)sulfanyl-N-methylacetamide (PubChem CID 130489954) has the molecular formula C7H8ClN3OS and a molecular weight of 217.68 g/mol. Its IUPAC name is 2-(6-chloropyrimidin-4-yl)sulfanyl-N-methylacetamide.
| Compound Name | 2-(6-chloropyrimidin-4-yl)sulfanyl-N-methylacetamide |
|---|---|
| PubChem CID | 130489954 |
| Molecular Formula | C7H8ClN3OS |
| Molecular Weight | 217.68 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | 2-(6-chloropyrimidin-4-yl)sulfanyl-N-methylacetamide |
| SMILES | CNC(=O)CSc1cc(Cl)ncn1 |
| InChI | InChI=1S/C7H8ClN3OS/c1-9-6(12)3-13-7-2-5(8)10-4-11-7/h2,4H,3H2,1H3,(H,9,12) |
| InChIKey | REEPBULBHTYHCF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.68 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |