C10H8Cl3N5O — CID 160592150
N-(6-chloropyrimidin-4-yl)acetamide;4,6-dichloropyrimidine (PubChem CID 160592150) has the molecular formula C10H8Cl3N5O and a molecular weight of 320.57 g/mol. Its IUPAC name is N-(6-chloropyrimidin-4-yl)acetamide;4,6-dichloropyrimidine.
| Compound Name | N-(6-chloropyrimidin-4-yl)acetamide;4,6-dichloropyrimidine |
|---|---|
| PubChem CID | 160592150 |
| Molecular Formula | C10H8Cl3N5O |
| Molecular Weight | 320.57 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | N-(6-chloropyrimidin-4-yl)acetamide;4,6-dichloropyrimidine |
| SMILES | CC(=O)Nc1cc(Cl)ncn1.Clc1cc(Cl)ncn1 |
| InChI | InChI=1S/C6H6ClN3O.C4H2Cl2N2/c1-4(11)10-6-2-5(7)8-3-9-6;5-3-1-4(6)8-2-7-3/h2-3H,1H3,(H,8,9,10,11);1-2H |
| InChIKey | RDDZWWFOKBGKIV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.57 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |