C12H8ClF2N3O — CID 114050076
N-(6-chloropyrimidin-4-yl)-2-(3,4-difluorophenyl)acetamide (PubChem CID 114050076) has the molecular formula C12H8ClF2N3O and a molecular weight of 283.67 g/mol. Its IUPAC name is N-(6-chloropyrimidin-4-yl)-2-(3,4-difluorophenyl)acetamide.
| Compound Name | N-(6-chloropyrimidin-4-yl)-2-(3,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 114050076 |
| Molecular Formula | C12H8ClF2N3O |
| Molecular Weight | 283.67 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | N-(6-chloropyrimidin-4-yl)-2-(3,4-difluorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(F)c(F)c1)Nc1cc(Cl)ncn1 |
| InChI | InChI=1S/C12H8ClF2N3O/c13-10-5-11(17-6-16-10)18-12(19)4-7-1-2-8(14)9(15)3-7/h1-3,5-6H,4H2,(H,16,17,18,19) |
| InChIKey | HUKVDVFIXOTBSS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.67 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |