C16H14ClF2NO — CID 114304849
N-[2-(1-chloroethyl)phenyl]-2-(3,4-difluorophenyl)acetamide (PubChem CID 114304849) has the molecular formula C16H14ClF2NO and a molecular weight of 309.74 g/mol. Its IUPAC name is N-[2-(1-chloroethyl)phenyl]-2-(3,4-difluorophenyl)acetamide.
| Compound Name | N-[2-(1-chloroethyl)phenyl]-2-(3,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 114304849 |
| Molecular Formula | C16H14ClF2NO |
| Molecular Weight | 309.74 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | N-[2-(1-chloroethyl)phenyl]-2-(3,4-difluorophenyl)acetamide |
| SMILES | CC(Cl)c1ccccc1NC(=O)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H14ClF2NO/c1-10(17)12-4-2-3-5-15(12)20-16(21)9-11-6-7-13(18)14(19)8-11/h2-8,10H,9H2,1H3,(H,20,21) |
| InChIKey | ZBRHWLZHLWQIKZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.74 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|