C14H10F2N2O3 — CID 104739842
3-[[2-(3,4-difluorophenyl)acetyl]amino]pyridine-2-carboxylic acid (PubChem CID 104739842) has the molecular formula C14H10F2N2O3 and a molecular weight of 292.24 g/mol. Its IUPAC name is 3-[[2-(3,4-difluorophenyl)acetyl]amino]pyridine-2-carboxylic acid.
| Compound Name | 3-[[2-(3,4-difluorophenyl)acetyl]amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 104739842 |
| Molecular Formula | C14H10F2N2O3 |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 3-[[2-(3,4-difluorophenyl)acetyl]amino]pyridine-2-carboxylic acid |
| SMILES | O=C(Cc1ccc(F)c(F)c1)Nc1cccnc1C(=O)O |
| InChI | InChI=1S/C14H10F2N2O3/c15-9-4-3-8(6-10(9)16)7-12(19)18-11-2-1-5-17-13(11)14(20)21/h1-6H,7H2,(H,18,19)(H,20,21) |
| InChIKey | JRPZUFMVSIXZPS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |