C11H7Cl3N4O — CID 117075041
1-(6-chloropyrimidin-4-yl)-3-(2,6-dichlorophenyl)urea (PubChem CID 117075041) has the molecular formula C11H7Cl3N4O and a molecular weight of 317.56 g/mol. Its IUPAC name is 1-(6-chloropyrimidin-4-yl)-3-(2,6-dichlorophenyl)urea.
| Compound Name | 1-(6-chloropyrimidin-4-yl)-3-(2,6-dichlorophenyl)urea |
|---|---|
| PubChem CID | 117075041 |
| Molecular Formula | C11H7Cl3N4O |
| Molecular Weight | 317.56 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 1-(6-chloropyrimidin-4-yl)-3-(2,6-dichlorophenyl)urea |
| SMILES | O=C(Nc1cc(Cl)ncn1)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H7Cl3N4O/c12-6-2-1-3-7(13)10(6)18-11(19)17-9-4-8(14)15-5-16-9/h1-5H,(H2,15,16,17,18,19) |
| InChIKey | FYIJZCWQGLHLMW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |