C11H9Cl2N3 — CID 66255009
6-chloro-N-(2-chloro-6-methylphenyl)pyrimidin-4-amine (PubChem CID 66255009) has the molecular formula C11H9Cl2N3 and a molecular weight of 254.12 g/mol. Its IUPAC name is 6-chloro-N-(2-chloro-6-methylphenyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-N-(2-chloro-6-methylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 66255009 |
| Molecular Formula | C11H9Cl2N3 |
| Molecular Weight | 254.12 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 6-chloro-N-(2-chloro-6-methylphenyl)pyrimidin-4-amine |
| SMILES | Cc1cccc(Cl)c1Nc1cc(Cl)ncn1 |
| InChI | InChI=1S/C11H9Cl2N3/c1-7-3-2-4-8(12)11(7)16-10-5-9(13)14-6-15-10/h2-6H,1H3,(H,14,15,16) |
| InChIKey | PVBYQICDESIZPQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.12 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |